C8H4F5N3 — CID 10105558
2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 10105558) has the molecular formula C8H4F5N3 and a molecular weight of 237.13 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 10105558 |
| Molecular Formula | C8H4F5N3 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | FC(F)(F)C(F)(F)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C8H4F5N3/c9-7(10,8(11,12)13)6-15-4-2-1-3-14-5(4)16-6/h1-3H,(H,14,15,16) |
| InChIKey | VGRGCVSHDGTMGT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|