C7H8Cl3NO2 — CID 101055879
2,2,2-trichloro-N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]acetamide (PubChem CID 101055879) has the molecular formula C7H8Cl3NO2 and a molecular weight of 244.51 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 101055879 |
| Molecular Formula | C7H8Cl3NO2 |
| Molecular Weight | 244.51 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | 2,2,2-trichloro-N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]acetamide |
| SMILES | O=C(N[C@H]1C=C[C@@H](O)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H8Cl3NO2/c8-7(9,10)6(13)11-4-1-2-5(12)3-4/h1-2,4-5,12H,3H2,(H,11,13)/t4-,5+/m0/s1 |
| InChIKey | CVRAKTDGPVZXDX-CRCLSJGQSA-N |
| XLogP | 1.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.51 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|