C11H8F3IO2 — CID 101055923
[(1R,2R)-2-iodo-2,3-dihydro-1H-inden-1-yl] 2,2,2-trifluoroacetate (PubChem CID 101055923) has the molecular formula C11H8F3IO2 and a molecular weight of 356.08 g/mol. Its IUPAC name is [(1R,2R)-2-iodo-2,3-dihydro-1H-inden-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,2R)-2-iodo-2,3-dihydro-1H-inden-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 101055923 |
| Molecular Formula | C11H8F3IO2 |
| Molecular Weight | 356.08 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | [(1R,2R)-2-iodo-2,3-dihydro-1H-inden-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@@H]1c2ccccc2C[C@H]1I)C(F)(F)F |
| InChI | InChI=1S/C11H8F3IO2/c12-11(13,14)10(16)17-9-7-4-2-1-3-6(7)5-8(9)15/h1-4,8-9H,5H2/t8-,9-/m1/s1 |
| InChIKey | CKXNPGZUHXEBBA-RKDXNWHRSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.08 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|