C13H24F6N2 — CID 101055983
N,N'-dibutyl-2,2,3,3,4,4-hexafluoropentane-1,5-diamine (PubChem CID 101055983) has the molecular formula C13H24F6N2 and a molecular weight of 322.34 g/mol. Its IUPAC name is N,N'-dibutyl-2,2,3,3,4,4-hexafluoropentane-1,5-diamine.
| Compound Name | N,N'-dibutyl-2,2,3,3,4,4-hexafluoropentane-1,5-diamine |
|---|---|
| PubChem CID | 101055983 |
| Molecular Formula | C13H24F6N2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N,N'-dibutyl-2,2,3,3,4,4-hexafluoropentane-1,5-diamine |
| SMILES | CCCCNCC(F)(F)C(F)(F)C(F)(F)CNCCCC |
| InChI | InChI=1S/C13H24F6N2/c1-3-5-7-20-9-11(14,15)13(18,19)12(16,17)10-21-8-6-4-2/h20-21H,3-10H2,1-2H3 |
| InChIKey | JOLFGLZRFWLQOO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|