C11H20F6N2 — CID 101055996
2,2,3,3,4,4-hexafluoro-N,N'-di(propan-2-yl)pentane-1,5-diamine (PubChem CID 101055996) has the molecular formula C11H20F6N2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-N,N'-di(propan-2-yl)pentane-1,5-diamine.
| Compound Name | 2,2,3,3,4,4-hexafluoro-N,N'-di(propan-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 101055996 |
| Molecular Formula | C11H20F6N2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-N,N'-di(propan-2-yl)pentane-1,5-diamine |
| SMILES | CC(C)NCC(F)(F)C(F)(F)C(F)(F)CNC(C)C |
| InChI | InChI=1S/C11H20F6N2/c1-7(2)18-5-9(12,13)11(16,17)10(14,15)6-19-8(3)4/h7-8,18-19H,5-6H2,1-4H3 |
| InChIKey | DCOSSCPKSBNSJK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|