C14H26O2Si2 — CID 101056018
(1R,2S,6R)-2-[[dimethyl(trimethylsilyloxy)silyl]methyl]bicyclo[4.2.0]octa-4,7-dien-1-ol (PubChem CID 101056018) has the molecular formula C14H26O2Si2 and a molecular weight of 282.53 g/mol. Its IUPAC name is (1R,2S,6R)-2-[[dimethyl(trimethylsilyloxy)silyl]methyl]bicyclo[4.2.0]octa-4,7-dien-1-ol.
| Compound Name | (1R,2S,6R)-2-[[dimethyl(trimethylsilyloxy)silyl]methyl]bicyclo[4.2.0]octa-4,7-dien-1-ol |
|---|---|
| PubChem CID | 101056018 |
| Molecular Formula | C14H26O2Si2 |
| Molecular Weight | 282.53 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1R,2S,6R)-2-[[dimethyl(trimethylsilyloxy)silyl]methyl]bicyclo[4.2.0]octa-4,7-dien-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)C[C@H]1CC=C[C@@H]2C=C[C@@]21O |
| InChI | InChI=1S/C14H26O2Si2/c1-17(2,3)16-18(4,5)11-13-8-6-7-12-9-10-14(12,13)15/h6-7,9-10,12-13,15H,8,11H2,1-5H3/t12-,13-,14-/m1/s1 |
| InChIKey | JVZWEEVKSFTABN-MGPQQGTHSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|