C18H24O6 — CID 101056030
dimethyl 2-[(E)-3-[(1R,2S)-2-(acetyloxymethyl)cyclopropyl]prop-2-enyl]-2-but-2-ynylpropanedioate (PubChem CID 101056030) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is dimethyl 2-[(E)-3-[(1R,2S)-2-(acetyloxymethyl)cyclopropyl]prop-2-enyl]-2-but-2-ynylpropanedioate.
| Compound Name | dimethyl 2-[(E)-3-[(1R,2S)-2-(acetyloxymethyl)cyclopropyl]prop-2-enyl]-2-but-2-ynylpropanedioate |
|---|---|
| PubChem CID | 101056030 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | dimethyl 2-[(E)-3-[(1R,2S)-2-(acetyloxymethyl)cyclopropyl]prop-2-enyl]-2-but-2-ynylpropanedioate |
| SMILES | CC#CCC(C/C=C/[C@H]1C[C@@H]1COC(C)=O)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H24O6/c1-5-6-9-18(16(20)22-3,17(21)23-4)10-7-8-14-11-15(14)12-24-13(2)19/h7-8,14-15H,9-12H2,1-4H3/b8-7+/t14-,15+/m0/s1 |
| InChIKey | FAQKLBJBVOKGLW-MHKRFPNSSA-N |
| XLogP | 1.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|