C26H23N3O8S — CID 101056125
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-(5-cyano-6-naphthalen-2-yl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxan-3-yl] acetate (PubChem CID 101056125) has the molecular formula C26H23N3O8S and a molecular weight of 537.55 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(5-cyano-6-naphthalen-2-yl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(5-cyano-6-naphthalen-2-yl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 101056125 |
| Molecular Formula | C26H23N3O8S |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(5-cyano-6-naphthalen-2-yl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1c(-c2ccc3ccccc3c2)c(C#N)c(=O)[nH]c1=S |
| InChI | InChI=1S/C26H23N3O8S/c1-13(30)35-20-12-34-25(23(37-15(3)32)22(20)36-14(2)31)29-21(19(11-27)24(33)28-26(29)38)18-9-8-16-6-4-5-7-17(16)10-18/h4-10,20,22-23,25H,12H2,1-3H3,(H,28,33,38)/t20-,22+,23-,25-/m1/s1 |
| InChIKey | MIKSIAWDJAEVSC-JVICHNFNSA-N |
| XLogP | 2.92 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|