C41H46N6O7S — CID 101056294
tert-butyl N-[(5S,6S)-7-[4-(3-aminophenoxy)anilino]-5-[[2-[[2-(2-cyanophenyl)sulfanylbenzoyl]-methylamino]acetyl]amino]-6-hydroxy-7-oxoheptyl]carbamate (PubChem CID 101056294) has the molecular formula C41H46N6O7S and a molecular weight of 766.92 g/mol. Its IUPAC name is tert-butyl N-[(5S,6S)-7-[4-(3-aminophenoxy)anilino]-5-[[2-[[2-(2-cyanophenyl)sulfanylbenzoyl]-methylamino]acetyl]amino]-6-hydroxy-7-oxoheptyl]carbamate.
| Compound Name | tert-butyl N-[(5S,6S)-7-[4-(3-aminophenoxy)anilino]-5-[[2-[[2-(2-cyanophenyl)sulfanylbenzoyl]-methylamino]acetyl]amino]-6-hydroxy-7-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 101056294 |
| Molecular Formula | C41H46N6O7S |
| Molecular Weight | 766.92 g/mol |
| Exact Mass | 766.31 |
| IUPAC Name | tert-butyl N-[(5S,6S)-7-[4-(3-aminophenoxy)anilino]-5-[[2-[[2-(2-cyanophenyl)sulfanylbenzoyl]-methylamino]acetyl]amino]-6-hydroxy-7-oxoheptyl]carbamate |
| SMILES | CN(CC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)[C@H](O)C(=O)Nc1ccc(Oc2cccc(N)c2)cc1)C(=O)c1ccccc1Sc1ccccc1C#N |
| InChI | InChI=1S/C41H46N6O7S/c1-41(2,3)54-40(52)44-23-10-9-16-33(37(49)38(50)45-29-19-21-30(22-20-29)53-31-14-11-13-28(43)24-31)46-36(48)26-47(4)39(51)32-15-6-8-18-35(32)55-34-17-7-5-12-27(34)25-42/h5-8,11-15,17-22,24,33,37,49H,9-10,16,23,26,43H2,1-4H3,(H,44,52)(H,45,50)(H,46,48)/t33-,37-/m0/s1 |
| InChIKey | VAVKNPXDSXOIQN-WNOXWKSXSA-N |
| XLogP | 6.34 |
| TPSA | 196.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.92 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|