(6E)-3,7,11-trimethyldodeca-6,10-dienoic acid

C15H26O2 — CID 10105638

IUPAC(6E)-3,7,11-trimethyldodeca-6,10-dienoic acid
SMILESCC(C)=CCC/C(C)=C/CCC(C)CC(=O)O
InChIInChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h7,9,14H,5-6,8,10-11H2,1-4H3,(H,16,17)/b13-9+
InChIKeyHDAQPCUHLCPEHS-UKTHLTGXSA-N
MW238.37 g/mol
LogP4.57
Rot. Bonds8

About (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid

(6E)-3,7,11-trimethyldodeca-6,10-dienoic acid (PubChem CID 10105638) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid.

Molecular Properties

Compound Name(6E)-3,7,11-trimethyldodeca-6,10-dienoic acid
PubChem CID10105638
Molecular FormulaC15H26O2
Molecular Weight238.37 g/mol
Exact Mass238.19
IUPAC Name(6E)-3,7,11-trimethyldodeca-6,10-dienoic acid
SMILESCC(C)=CCC/C(C)=C/CCC(C)CC(=O)O
InChIInChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h7,9,14H,5-6,8,10-11H2,1-4H3,(H,16,17)/b13-9+
InChIKeyHDAQPCUHLCPEHS-UKTHLTGXSA-N
XLogP4.57
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.37
LogP ≤ 54.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid?
The IUPAC name of (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid (CID 10105638) is (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid.
What is the SMILES notation for (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid?
The canonical SMILES for (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid is CC(C)=CCC/C(C)=C/CCC(C)CC(=O)O.
What is the InChIKey of (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid?
The InChIKey is HDAQPCUHLCPEHS-UKTHLTGXSA-N. The full InChI is InChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h7,9,14H,5-6,8,10-11H2,1-4H3,(H,16,17)/b13-9+.
What are the key properties of (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid?
(6E)-3,7,11-trimethyldodeca-6,10-dienoic acid has a molecular weight of 238.37 g/mol, XLogP of 4.57, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-3,7,11-trimethyldodeca-6,10-dienoic acid is sourced from PubChem (CID 10105638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).