About [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane
[(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane (PubChem CID 10105645) has the molecular formula C13H22O2Si
and a molecular weight of 238.40 g/mol. Its IUPAC name is [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane |
| PubChem CID | 10105645 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane |
| SMILES | C/C(=C/C#C[Si](C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H22O2Si/c1-11(8-7-9-16(4,5)6)12-10-14-13(2,3)15-12/h8,12H,10H2,1-6H3/b11-8-/t12-/m1/s1 |
| InChIKey | CCWPXOQGIYCFFE-NXIHDVOMSA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane?
The IUPAC name of [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane (CID 10105645) is [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane.
What is the SMILES notation for [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane?
The canonical SMILES for [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane is C/C(=C/C#C[Si](C)(C)C)[C@H]1COC(C)(C)O1.
What is the InChIKey of [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane?
The InChIKey is CCWPXOQGIYCFFE-NXIHDVOMSA-N. The full InChI is InChI=1S/C13H22O2Si/c1-11(8-7-9-16(4,5)6)12-10-14-13(2,3)15-12/h8,12H,10H2,1-6H3/b11-8-/t12-/m1/s1.
What are the key properties of [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane?
[(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane has a molecular weight of 238.40 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-en-1-ynyl]-trimethylsilane is sourced from PubChem (CID 10105645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).