About 4-methyl-1H-benzo[g]quinoline-2,5,10-trione
4-methyl-1H-benzo[g]quinoline-2,5,10-trione (PubChem CID 10105653) has the molecular formula C14H9NO3
and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-methyl-1H-benzo[g]quinoline-2,5,10-trione.
Molecular Properties
| Compound Name | 4-methyl-1H-benzo[g]quinoline-2,5,10-trione |
| PubChem CID | 10105653 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 4-methyl-1H-benzo[g]quinoline-2,5,10-trione |
| SMILES | Cc1cc(=O)[nH]c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO3/c1-7-6-10(16)15-12-11(7)13(17)8-4-2-3-5-9(8)14(12)18/h2-6H,1H3,(H,15,16) |
| InChIKey | GYAHTYNHCVTZOK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1H-benzo[g]quinoline-2,5,10-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1H-benzo[g]quinoline-2,5,10-trione?
The IUPAC name of 4-methyl-1H-benzo[g]quinoline-2,5,10-trione (CID 10105653) is 4-methyl-1H-benzo[g]quinoline-2,5,10-trione.
What is the SMILES notation for 4-methyl-1H-benzo[g]quinoline-2,5,10-trione?
The canonical SMILES for 4-methyl-1H-benzo[g]quinoline-2,5,10-trione is Cc1cc(=O)[nH]c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 4-methyl-1H-benzo[g]quinoline-2,5,10-trione?
The InChIKey is GYAHTYNHCVTZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO3/c1-7-6-10(16)15-12-11(7)13(17)8-4-2-3-5-9(8)14(12)18/h2-6H,1H3,(H,15,16).
What are the key properties of 4-methyl-1H-benzo[g]quinoline-2,5,10-trione?
4-methyl-1H-benzo[g]quinoline-2,5,10-trione has a molecular weight of 239.23 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-benzo[g]quinoline-2,5,10-trione is sourced from PubChem (CID 10105653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).