About 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one
1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one (PubChem CID 101056755) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one.
Molecular Properties
| Compound Name | 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one |
| PubChem CID | 101056755 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one |
| SMILES | CCC[C@@H](O)C[C@H]1CCC[C@@H](CC(C)=O)N1 |
| InChI | InChI=1S/C13H25NO2/c1-3-5-13(16)9-12-7-4-6-11(14-12)8-10(2)15/h11-14,16H,3-9H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | GFVMHSQLCIEXNG-YNEHKIRRSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one?
The IUPAC name of 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one (CID 101056755) is 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one.
What is the SMILES notation for 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one?
The canonical SMILES for 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one is CCC[C@@H](O)C[C@H]1CCC[C@@H](CC(C)=O)N1.
What is the InChIKey of 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one?
The InChIKey is GFVMHSQLCIEXNG-YNEHKIRRSA-N. The full InChI is InChI=1S/C13H25NO2/c1-3-5-13(16)9-12-7-4-6-11(14-12)8-10(2)15/h11-14,16H,3-9H2,1-2H3/t11-,12+,13+/m0/s1.
What are the key properties of 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one?
1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one has a molecular weight of 227.35 g/mol, XLogP of 2.03, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,6R)-6-[(2R)-2-hydroxypentyl]piperidin-2-yl]propan-2-one is sourced from PubChem (CID 101056755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).