About (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole
(2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole (PubChem CID 101056778) has the molecular formula C25H25NO3S
and a molecular weight of 419.55 g/mol. Its IUPAC name is (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole |
| PubChem CID | 101056778 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](COCc3ccccc3)C=C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-20-12-15-24(16-13-20)30(27,28)26-23(19-29-18-21-8-4-2-5-9-21)14-17-25(26)22-10-6-3-7-11-22/h2-17,23,25H,18-19H2,1H3/t23-,25-/m0/s1 |
| InChIKey | PJEFHXZXGMSWNO-ZCYQVOJMSA-N |
| XLogP | 4.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole?
The IUPAC name of (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole (CID 101056778) is (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole.
What is the SMILES notation for (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole?
The canonical SMILES for (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole is Cc1ccc(S(=O)(=O)N2[C@H](COCc3ccccc3)C=C[C@H]2c2ccccc2)cc1.
What is the InChIKey of (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole?
The InChIKey is PJEFHXZXGMSWNO-ZCYQVOJMSA-N. The full InChI is InChI=1S/C25H25NO3S/c1-20-12-15-24(16-13-20)30(27,28)26-23(19-29-18-21-8-4-2-5-9-21)14-17-25(26)22-10-6-3-7-11-22/h2-17,23,25H,18-19H2,1H3/t23-,25-/m0/s1.
What are the key properties of (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole?
(2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole has a molecular weight of 419.55 g/mol, XLogP of 4.88, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-1-(4-methylphenyl)sulfonyl-2-phenyl-5-(phenylmethoxymethyl)-2,5-dihydropyrrole is sourced from PubChem (CID 101056778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).