C15H8Cl4O6 — CID 101057066
(2S,3R,5S,6R,8S,9R,11S,12R)-4,10-dioxahexacyclo[5.5.1.02,6.03,5.08,12.09,11]tridecane-3,5,9,11-tetracarbonyl chloride (PubChem CID 101057066) has the molecular formula C15H8Cl4O6 and a molecular weight of 426.04 g/mol. Its IUPAC name is (2S,3R,5S,6R,8S,9R,11S,12R)-4,10-dioxahexacyclo[5.5.1.02,6.03,5.08,12.09,11]tridecane-3,5,9,11-tetracarbonyl chloride.
| Compound Name | (2S,3R,5S,6R,8S,9R,11S,12R)-4,10-dioxahexacyclo[5.5.1.02,6.03,5.08,12.09,11]tridecane-3,5,9,11-tetracarbonyl chloride |
|---|---|
| PubChem CID | 101057066 |
| Molecular Formula | C15H8Cl4O6 |
| Molecular Weight | 426.04 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | (2S,3R,5S,6R,8S,9R,11S,12R)-4,10-dioxahexacyclo[5.5.1.02,6.03,5.08,12.09,11]tridecane-3,5,9,11-tetracarbonyl chloride |
| SMILES | O=C(Cl)[C@]12O[C@@]1(C(=O)Cl)[C@@H]1C3CC([C@@H]4[C@H]3[C@@]3(C(=O)Cl)O[C@@]43C(=O)Cl)[C@@H]12 |
| InChI | InChI=1S/C15H8Cl4O6/c16-8(20)12-4-2-1-3(6(4)14(12,24-12)10(18)22)7-5(2)13(9(17)21)15(7,25-13)11(19)23/h2-7H,1H2/t2?,3?,4-,5+,6+,7-,12-,13+,14+,15- |
| InChIKey | QYWQCRJNQPBCBW-LHRORBDZSA-N |
| XLogP | 1.21 |
| TPSA | 93.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.04 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|