C13H20O4 — CID 101057590
(2R,3S,6S)-2-(hydroxymethyl)-6-[(3E)-4-methylhexa-3,5-dienoxy]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 101057590) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (2R,3S,6S)-2-(hydroxymethyl)-6-[(3E)-4-methylhexa-3,5-dienoxy]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,6S)-2-(hydroxymethyl)-6-[(3E)-4-methylhexa-3,5-dienoxy]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 101057590 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (2R,3S,6S)-2-(hydroxymethyl)-6-[(3E)-4-methylhexa-3,5-dienoxy]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | C=C/C(C)=C/CCO[C@@H]1C=C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C13H20O4/c1-3-10(2)5-4-8-16-13-7-6-11(15)12(9-14)17-13/h3,5-7,11-15H,1,4,8-9H2,2H3/b10-5+/t11-,12+,13-/m0/s1 |
| InChIKey | NYTUPXVTNZNOLT-ZFNYCVFOSA-N |
| XLogP | 1.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|