About 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine
9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine (PubChem CID 10105826) has the molecular formula C10H9N7O
and a molecular weight of 243.23 g/mol. Its IUPAC name is 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine.
Molecular Properties
| Compound Name | 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine |
| PubChem CID | 10105826 |
| Molecular Formula | C10H9N7O |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine |
| SMILES | c1nc(-n2cncn2)c2ncn(CC3CO3)c2n1 |
| InChI | InChI=1S/C10H9N7O/c1(7-2-18-7)16-6-14-8-9(16)12-4-13-10(8)17-5-11-3-15-17/h3-7H,1-2H2 |
| InChIKey | WUISPYDKDOOZGT-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 86.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine?
The IUPAC name of 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine (CID 10105826) is 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine.
What is the SMILES notation for 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine?
The canonical SMILES for 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine is c1nc(-n2cncn2)c2ncn(CC3CO3)c2n1.
What is the InChIKey of 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine?
The InChIKey is WUISPYDKDOOZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N7O/c1(7-2-18-7)16-6-14-8-9(16)12-4-13-10(8)17-5-11-3-15-17/h3-7H,1-2H2.
What are the key properties of 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine?
9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine has a molecular weight of 243.23 g/mol, XLogP of -0.19, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(oxiran-2-ylmethyl)-6-(1,2,4-triazol-1-yl)purine is sourced from PubChem (CID 10105826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).