About 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one
1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one (PubChem CID 10105847) has the molecular formula C11H21N3OS
and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one.
Molecular Properties
| Compound Name | 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one |
| PubChem CID | 10105847 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one |
| SMILES | CCN(CC)CCC(=O)C1SC(N)=NC1C |
| InChI | InChI=1S/C11H21N3OS/c1-4-14(5-2)7-6-9(15)10-8(3)13-11(12)16-10/h8,10H,4-7H2,1-3H3,(H2,12,13) |
| InChIKey | FTDBTFQXKQQGOW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one?
The IUPAC name of 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one (CID 10105847) is 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one.
What is the SMILES notation for 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one?
The canonical SMILES for 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one is CCN(CC)CCC(=O)C1SC(N)=NC1C.
What is the InChIKey of 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one?
The InChIKey is FTDBTFQXKQQGOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3OS/c1-4-14(5-2)7-6-9(15)10-8(3)13-11(12)16-10/h8,10H,4-7H2,1-3H3,(H2,12,13).
What are the key properties of 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one?
1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one has a molecular weight of 243.38 g/mol, XLogP of 1.11, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-4-methyl-4,5-dihydro-1,3-thiazol-5-yl)-3-(diethylamino)propan-1-one is sourced from PubChem (CID 10105847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).