C18H36O2Si — CID 101059160
2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methylcycloheptan-1-one (PubChem CID 101059160) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methylcycloheptan-1-one.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methylcycloheptan-1-one |
|---|---|
| PubChem CID | 101059160 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-methylcycloheptan-1-one |
| SMILES | CC1CCC(=O)C(CCCCO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H36O2Si/c1-15-10-12-16(17(19)13-11-15)9-7-8-14-20-21(5,6)18(2,3)4/h15-16H,7-14H2,1-6H3 |
| InChIKey | JPBBHHCGDGWAQC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|