C8H11F5N2O — CID 10105941
2,2,3,3,3-pentafluoro-1-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 10105941) has the molecular formula C8H11F5N2O and a molecular weight of 246.18 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-methylpiperazin-1-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-methylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 10105941 |
| Molecular Formula | C8H11F5N2O |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | CN1CCN(C(=O)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H11F5N2O/c1-14-2-4-15(5-3-14)6(16)7(9,10)8(11,12)13/h2-5H2,1H3 |
| InChIKey | SWEUZUYFAIQWGA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|