C29H28OSi — CID 101060034
[(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]methyl-triphenylsilane (PubChem CID 101060034) has the molecular formula C29H28OSi and a molecular weight of 420.63 g/mol. Its IUPAC name is [(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]methyl-triphenylsilane.
| Compound Name | [(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]methyl-triphenylsilane |
|---|---|
| PubChem CID | 101060034 |
| Molecular Formula | C29H28OSi |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | [(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]methyl-triphenylsilane |
| SMILES | COc1ccc([C@H]2C[C@@H]2C[Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H28OSi/c1-30-25-19-17-23(18-20-25)29-21-24(29)22-31(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-20,24,29H,21-22H2,1H3/t24-,29-/m1/s1 |
| InChIKey | LSQDCSYVXCOAGH-FUFSCUOVSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|