C20H46OSi4 — CID 101060052
[2,4-ditert-butyl-1,1-bis(trimethylsilyl)silet-2-yl]oxy-trimethylsilane (PubChem CID 101060052) has the molecular formula C20H46OSi4 and a molecular weight of 414.93 g/mol. Its IUPAC name is [2,4-ditert-butyl-1,1-bis(trimethylsilyl)silet-2-yl]oxy-trimethylsilane.
| Compound Name | [2,4-ditert-butyl-1,1-bis(trimethylsilyl)silet-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101060052 |
| Molecular Formula | C20H46OSi4 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [2,4-ditert-butyl-1,1-bis(trimethylsilyl)silet-2-yl]oxy-trimethylsilane |
| SMILES | CC(C)(C)C1=CC(O[Si](C)(C)C)(C(C)(C)C)[Si]1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H46OSi4/c1-18(2,3)17-16-20(19(4,5)6,21-22(7,8)9)25(17,23(10,11)12)24(13,14)15/h16H,1-15H3 |
| InChIKey | KRZYGEUPTCZWHU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|