C17H22N4OSi — CID 101060238
3-[tert-butyl(dimethyl)silyl]oxy-6-methylcyclohex-4-ene-1,1,2,2-tetracarbonitrile (PubChem CID 101060238) has the molecular formula C17H22N4OSi and a molecular weight of 326.48 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-6-methylcyclohex-4-ene-1,1,2,2-tetracarbonitrile.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-6-methylcyclohex-4-ene-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 101060238 |
| Molecular Formula | C17H22N4OSi |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-6-methylcyclohex-4-ene-1,1,2,2-tetracarbonitrile |
| SMILES | CC1C=CC(O[Si](C)(C)C(C)(C)C)C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C17H22N4OSi/c1-13-7-8-14(22-23(5,6)15(2,3)4)17(11-20,12-21)16(13,9-18)10-19/h7-8,13-14H,1-6H3 |
| InChIKey | WDBWZQVBOIRGIE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|