C15H18N4OSi — CID 101060243
3,3-dimethyl-5-trimethylsilyloxycyclohex-4-ene-1,1,2,2-tetracarbonitrile (PubChem CID 101060243) has the molecular formula C15H18N4OSi and a molecular weight of 298.42 g/mol. Its IUPAC name is 3,3-dimethyl-5-trimethylsilyloxycyclohex-4-ene-1,1,2,2-tetracarbonitrile.
| Compound Name | 3,3-dimethyl-5-trimethylsilyloxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 101060243 |
| Molecular Formula | C15H18N4OSi |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3,3-dimethyl-5-trimethylsilyloxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
| SMILES | CC1(C)C=C(O[Si](C)(C)C)CC(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C15H18N4OSi/c1-13(2)6-12(20-21(3,4)5)7-14(8-16,9-17)15(13,10-18)11-19/h6H,7H2,1-5H3 |
| InChIKey | SOUDTUXHMCFXII-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|