About ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate
ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate (PubChem CID 10106043) has the molecular formula C10H16O7
and a molecular weight of 248.23 g/mol. Its IUPAC name is ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate |
| PubChem CID | 10106043 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate |
| SMILES | CCOC(=O)C1OCC(O)C(O)C1OC(C)=O |
| InChI | InChI=1S/C10H16O7/c1-3-15-10(14)9-8(17-5(2)11)7(13)6(12)4-16-9/h6-9,12-13H,3-4H2,1-2H3 |
| InChIKey | XSMRYIAZMDEVLN-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate?
The IUPAC name of ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate (CID 10106043) is ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate.
What is the SMILES notation for ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate?
The canonical SMILES for ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate is CCOC(=O)C1OCC(O)C(O)C1OC(C)=O.
What is the InChIKey of ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate?
The InChIKey is XSMRYIAZMDEVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O7/c1-3-15-10(14)9-8(17-5(2)11)7(13)6(12)4-16-9/h6-9,12-13H,3-4H2,1-2H3.
What are the key properties of ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate?
ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate has a molecular weight of 248.23 g/mol, XLogP of -1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-acetyloxy-4,5-dihydroxyoxane-2-carboxylate is sourced from PubChem (CID 10106043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).