C20H28Si — CID 101060468
2,2-bis[(2R)-2-methylbutyl]-2-silatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene (PubChem CID 101060468) has the molecular formula C20H28Si and a molecular weight of 296.53 g/mol. Its IUPAC name is 2,2-bis[(2R)-2-methylbutyl]-2-silatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene.
| Compound Name | 2,2-bis[(2R)-2-methylbutyl]-2-silatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene |
|---|---|
| PubChem CID | 101060468 |
| Molecular Formula | C20H28Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2,2-bis[(2R)-2-methylbutyl]-2-silatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene |
| SMILES | CC[C@@H](C)C[Si]1(C[C@H](C)CC)c2cccc3cccc1c23 |
| InChI | InChI=1S/C20H28Si/c1-5-15(3)13-21(14-16(4)6-2)18-11-7-9-17-10-8-12-19(21)20(17)18/h7-12,15-16H,5-6,13-14H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | IDJXXSANCMTCCZ-HZPDHXFCSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|