C22H27NO4Si — CID 101060892
2-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 101060892) has the molecular formula C22H27NO4Si and a molecular weight of 397.55 g/mol. Its IUPAC name is 2-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101060892 |
| Molecular Formula | C22H27NO4Si |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(CON2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H27NO4Si/c1-22(2,3)28(4,5)27-15-17-12-10-16(11-13-17)14-26-23-20(24)18-8-6-7-9-19(18)21(23)25/h6-13H,14-15H2,1-5H3 |
| InChIKey | HCXBVOSKBFPRFY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|