C21H37N3O5Si — CID 101061554
ethyl 4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-amino-1H-pyrrole-2-carboxylate (PubChem CID 101061554) has the molecular formula C21H37N3O5Si and a molecular weight of 439.63 g/mol. Its IUPAC name is ethyl 4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-amino-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-amino-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 101061554 |
| Molecular Formula | C21H37N3O5Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | ethyl 4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-amino-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc([C@@H]2N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OC(C)(C)O[C@H]32)c1N |
| InChI | InChI=1S/C21H37N3O5Si/c1-9-26-19(25)16-14(22)12(10-23-16)15-18-17(28-21(5,6)29-18)13(24-15)11-27-30(7,8)20(2,3)4/h10,13,15,17-18,23-24H,9,11,22H2,1-8H3/t13-,15+,17-,18+/m1/s1 |
| InChIKey | AIAPGNAQNDXQRJ-SIUPPRGNSA-N |
| XLogP | 3.33 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|