About 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol
2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol (PubChem CID 10106208) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol |
| PubChem CID | 10106208 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol |
| SMILES | Cc1cc(N2CCCN(CCO)CC2)nc(N)n1 |
| InChI | InChI=1S/C12H21N5O/c1-10-9-11(15-12(13)14-10)17-4-2-3-16(5-6-17)7-8-18/h9,18H,2-8H2,1H3,(H2,13,14,15) |
| InChIKey | KOALMJBXKFHGCK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol?
The IUPAC name of 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol (CID 10106208) is 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol.
What is the SMILES notation for 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol?
The canonical SMILES for 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol is Cc1cc(N2CCCN(CCO)CC2)nc(N)n1.
What is the InChIKey of 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol?
The InChIKey is KOALMJBXKFHGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-10-9-11(15-12(13)14-10)17-4-2-3-16(5-6-17)7-8-18/h9,18H,2-8H2,1H3,(H2,13,14,15).
What are the key properties of 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol?
2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol has a molecular weight of 251.33 g/mol, XLogP of -0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol is sourced from PubChem (CID 10106208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).