About (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid
(5Z,9Z)-14-methylpentadeca-5,9-dienoic acid (PubChem CID 10106262) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid.
Molecular Properties
| Compound Name | (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid |
| PubChem CID | 10106262 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid |
| SMILES | CC(C)CCC/C=C\CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C16H28O2/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14-16(17)18/h5-8,15H,3-4,9-14H2,1-2H3,(H,17,18)/b7-5-,8-6- |
| InChIKey | PKYKYVUOJCITJQ-SFECMWDFSA-N |
| XLogP | 4.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid?
The IUPAC name of (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid (CID 10106262) is (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid.
What is the SMILES notation for (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid?
The canonical SMILES for (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid is CC(C)CCC/C=C\CC/C=C\CCCC(=O)O.
What is the InChIKey of (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid?
The InChIKey is PKYKYVUOJCITJQ-SFECMWDFSA-N. The full InChI is InChI=1S/C16H28O2/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14-16(17)18/h5-8,15H,3-4,9-14H2,1-2H3,(H,17,18)/b7-5-,8-6-.
What are the key properties of (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid?
(5Z,9Z)-14-methylpentadeca-5,9-dienoic acid has a molecular weight of 252.40 g/mol, XLogP of 4.96, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,9Z)-14-methylpentadeca-5,9-dienoic acid is sourced from PubChem (CID 10106262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).