C30H28N2O4 — CID 101062797
dimethyl (1S,2R,3aS)-1,10-diphenyl-1,2,3,4,9,10-hexahydroindolizino[6,7-b]indole-2,3a-dicarboxylate (PubChem CID 101062797) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is dimethyl (1S,2R,3aS)-1,10-diphenyl-1,2,3,4,9,10-hexahydroindolizino[6,7-b]indole-2,3a-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3aS)-1,10-diphenyl-1,2,3,4,9,10-hexahydroindolizino[6,7-b]indole-2,3a-dicarboxylate |
|---|---|
| PubChem CID | 101062797 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | dimethyl (1S,2R,3aS)-1,10-diphenyl-1,2,3,4,9,10-hexahydroindolizino[6,7-b]indole-2,3a-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(C(=O)OC)Cc3c([nH]c4ccccc34)C(c3ccccc3)N2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H28N2O4/c1-35-28(33)23-18-30(29(34)36-2)17-22-21-15-9-10-16-24(21)31-25(22)27(20-13-7-4-8-14-20)32(30)26(23)19-11-5-3-6-12-19/h3-16,23,26-27,31H,17-18H2,1-2H3/t23-,26-,27?,30-/m1/s1 |
| InChIKey | KKACTIYJEVYYJC-QJWDZKDTSA-N |
| XLogP | 4.96 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|