About (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane
(1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane (PubChem CID 101062841) has the molecular formula C13H28O2Si
and a molecular weight of 244.45 g/mol. Its IUPAC name is (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane.
Molecular Properties
| Compound Name | (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane |
| PubChem CID | 101062841 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane |
| SMILES | CCOC1(O[Si](C)(C)C)CCCCC1(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-7-14-13(15-16(4,5)6)11-9-8-10-12(13,2)3/h7-11H2,1-6H3 |
| InChIKey | RFPYOOGPHFLOEZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane?
The IUPAC name of (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane (CID 101062841) is (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane.
What is the SMILES notation for (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane?
The canonical SMILES for (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane is CCOC1(O[Si](C)(C)C)CCCCC1(C)C.
What is the InChIKey of (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane?
The InChIKey is RFPYOOGPHFLOEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2Si/c1-7-14-13(15-16(4,5)6)11-9-8-10-12(13,2)3/h7-11H2,1-6H3.
What are the key properties of (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane?
(1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane has a molecular weight of 244.45 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-2,2-dimethylcyclohexyl)oxy-trimethylsilane is sourced from PubChem (CID 101062841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).