C17H22O9 — CID 101062861
2-O-ethyl 3-O,4-O-dimethyl (1R,2R,6S)-1-methoxy-6-methyl-5-oxo-9-oxabicyclo[4.2.1]non-7-ene-2,3,4-tricarboxylate (PubChem CID 101062861) has the molecular formula C17H22O9 and a molecular weight of 370.35 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl (1R,2R,6S)-1-methoxy-6-methyl-5-oxo-9-oxabicyclo[4.2.1]non-7-ene-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl (1R,2R,6S)-1-methoxy-6-methyl-5-oxo-9-oxabicyclo[4.2.1]non-7-ene-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 101062861 |
| Molecular Formula | C17H22O9 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl (1R,2R,6S)-1-methoxy-6-methyl-5-oxo-9-oxabicyclo[4.2.1]non-7-ene-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(C(=O)OC)C(C(=O)OC)C(=O)[C@]2(C)C=C[C@@]1(OC)O2 |
| InChI | InChI=1S/C17H22O9/c1-6-25-15(21)11-9(13(19)22-3)10(14(20)23-4)12(18)16(2)7-8-17(11,24-5)26-16/h7-11H,6H2,1-5H3/t9?,10?,11-,16-,17+/m0/s1 |
| InChIKey | WIHKYHMRKUTDHY-DWHYUURHSA-N |
| XLogP | 0.01 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|