[(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate

C5H13O6P — CID 101063005

IUPAC[(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate
SMILESCCOP(=O)(O)OC[C@H](O)CO
InChIInChI=1S/C5H13O6P/c1-2-10-12(8,9)11-4-5(7)3-6/h5-7H,2-4H2,1H3,(H,8,9)/t5-/m1/s1
InChIKeyDXARXEBAXKHIOU-RXMQYKEDSA-N
MW200.13 g/mol
LogP-0.51
Rot. Bonds6

About [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate

[(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate (PubChem CID 101063005) has the molecular formula C5H13O6P and a molecular weight of 200.13 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate.

Molecular Properties

Compound Name[(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate
PubChem CID101063005
Molecular FormulaC5H13O6P
Molecular Weight200.13 g/mol
Exact Mass200.04
IUPAC Name[(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate
SMILESCCOP(=O)(O)OC[C@H](O)CO
InChIInChI=1S/C5H13O6P/c1-2-10-12(8,9)11-4-5(7)3-6/h5-7H,2-4H2,1H3,(H,8,9)/t5-/m1/s1
InChIKeyDXARXEBAXKHIOU-RXMQYKEDSA-N
XLogP-0.51
TPSA96.22 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.13
LogP ≤ 5-0.51
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate?
The IUPAC name of [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate (CID 101063005) is [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate.
What is the SMILES notation for [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate?
The canonical SMILES for [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate is CCOP(=O)(O)OC[C@H](O)CO.
What is the InChIKey of [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate?
The InChIKey is DXARXEBAXKHIOU-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H13O6P/c1-2-10-12(8,9)11-4-5(7)3-6/h5-7H,2-4H2,1H3,(H,8,9)/t5-/m1/s1.
What are the key properties of [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate?
[(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate has a molecular weight of 200.13 g/mol, XLogP of -0.51, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3-dihydroxypropyl] ethyl hydrogen phosphate is sourced from PubChem (CID 101063005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).