About (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine
(2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine (PubChem CID 101063072) has the molecular formula C18H22NOP
and a molecular weight of 299.35 g/mol. Its IUPAC name is (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine |
| PubChem CID | 101063072 |
| Molecular Formula | C18H22NOP |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine |
| SMILES | C[C@H]1C[C@@H](C)N(P(=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C18H22NOP/c1-15-13-16(2)19(14-15)21(20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | UHTIKNCSYOCXSM-JKSUJKDBSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine?
The IUPAC name of (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine (CID 101063072) is (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine.
What is the SMILES notation for (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine?
The canonical SMILES for (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine is C[C@H]1C[C@@H](C)N(P(=O)(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine?
The InChIKey is UHTIKNCSYOCXSM-JKSUJKDBSA-N. The full InChI is InChI=1S/C18H22NOP/c1-15-13-16(2)19(14-15)21(20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3/t15-,16+/m0/s1.
What are the key properties of (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine?
(2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine has a molecular weight of 299.35 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-1-diphenylphosphoryl-2,4-dimethylpyrrolidine is sourced from PubChem (CID 101063072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).