C18H30O8 — CID 101063688
(3R,6S)-3-[2-[2-[2-[(3R,6S)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]ethoxy]ethoxy]ethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 101063688) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is (3R,6S)-3-[2-[2-[2-[(3R,6S)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]ethoxy]ethoxy]ethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3R,6S)-3-[2-[2-[2-[(3R,6S)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]ethoxy]ethoxy]ethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 101063688 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (3R,6S)-3-[2-[2-[2-[(3R,6S)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]ethoxy]ethoxy]ethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | O[C@H]1COC2C1OC[C@H]2CCOCCOCC[C@@H]1COC2C1OC[C@@H]2O |
| InChI | InChI=1S/C18H30O8/c19-13-9-25-15-11(7-23-17(13)15)1-3-21-5-6-22-4-2-12-8-24-18-14(20)10-26-16(12)18/h11-20H,1-10H2/t11-,12-,13+,14+,15?,16?,17?,18?/m1/s1 |
| InChIKey | SFRYXGNWUOPUMU-PVYWEVGCSA-N |
| XLogP | -0.65 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|