C18H27IO2 — CID 101063730
(4aR,4bS,8aS,9aS)-7-iodo-5-methyl-5-(4-methylpent-3-enyl)-2,3,4,4a,4b,8,8a,9a-octahydropyrano[2,3-b][1]benzofuran (PubChem CID 101063730) has the molecular formula C18H27IO2 and a molecular weight of 402.32 g/mol. Its IUPAC name is (4aR,4bS,8aS,9aS)-7-iodo-5-methyl-5-(4-methylpent-3-enyl)-2,3,4,4a,4b,8,8a,9a-octahydropyrano[2,3-b][1]benzofuran.
| Compound Name | (4aR,4bS,8aS,9aS)-7-iodo-5-methyl-5-(4-methylpent-3-enyl)-2,3,4,4a,4b,8,8a,9a-octahydropyrano[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 101063730 |
| Molecular Formula | C18H27IO2 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (4aR,4bS,8aS,9aS)-7-iodo-5-methyl-5-(4-methylpent-3-enyl)-2,3,4,4a,4b,8,8a,9a-octahydropyrano[2,3-b][1]benzofuran |
| SMILES | CC(C)=CCCC1(C)C=C(I)C[C@@H]2O[C@@H]3OCCC[C@@H]3[C@H]21 |
| InChI | InChI=1S/C18H27IO2/c1-12(2)6-4-8-18(3)11-13(19)10-15-16(18)14-7-5-9-20-17(14)21-15/h6,11,14-17H,4-5,7-10H2,1-3H3/t14-,15+,16-,17+,18?/m1/s1 |
| InChIKey | ONDVKJJAUZDQSV-WXCOAYGQSA-N |
| XLogP | 5.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|