C18H27IO2 — CID 101063744
(2S,4E,4aR,8aS)-4-(iodomethylidene)-2-(2,6,6-trimethylcyclohexen-1-yl)-3,4a,5,6,7,8a-hexahydro-2H-pyrano[2,3-b]pyran (PubChem CID 101063744) has the molecular formula C18H27IO2 and a molecular weight of 402.32 g/mol. Its IUPAC name is (2S,4E,4aR,8aS)-4-(iodomethylidene)-2-(2,6,6-trimethylcyclohexen-1-yl)-3,4a,5,6,7,8a-hexahydro-2H-pyrano[2,3-b]pyran.
| Compound Name | (2S,4E,4aR,8aS)-4-(iodomethylidene)-2-(2,6,6-trimethylcyclohexen-1-yl)-3,4a,5,6,7,8a-hexahydro-2H-pyrano[2,3-b]pyran |
|---|---|
| PubChem CID | 101063744 |
| Molecular Formula | C18H27IO2 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (2S,4E,4aR,8aS)-4-(iodomethylidene)-2-(2,6,6-trimethylcyclohexen-1-yl)-3,4a,5,6,7,8a-hexahydro-2H-pyrano[2,3-b]pyran |
| SMILES | CC1=C([C@@H]2C/C(=C\I)[C@H]3CCCO[C@H]3O2)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H27IO2/c1-12-6-4-8-18(2,3)16(12)15-10-13(11-19)14-7-5-9-20-17(14)21-15/h11,14-15,17H,4-10H2,1-3H3/b13-11+/t14-,15+,17+/m1/s1 |
| InChIKey | FMSUBCRNOVXCKP-JVQNCRLTSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|