C8H4ClF5N2O — CID 101063992
(3aS,6S,7aR)-6-chloro-3a,4,5,6,7a-pentafluorospiro[3H-indazole-7,2'-oxirane] (PubChem CID 101063992) has the molecular formula C8H4ClF5N2O and a molecular weight of 274.58 g/mol. Its IUPAC name is (3aS,6S,7aR)-6-chloro-3a,4,5,6,7a-pentafluorospiro[3H-indazole-7,2'-oxirane].
| Compound Name | (3aS,6S,7aR)-6-chloro-3a,4,5,6,7a-pentafluorospiro[3H-indazole-7,2'-oxirane] |
|---|---|
| PubChem CID | 101063992 |
| Molecular Formula | C8H4ClF5N2O |
| Molecular Weight | 274.58 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | (3aS,6S,7aR)-6-chloro-3a,4,5,6,7a-pentafluorospiro[3H-indazole-7,2'-oxirane] |
| SMILES | FC1=C(F)[C@@]2(F)CN=N[C@@]2(F)C2(CO2)[C@]1(F)Cl |
| InChI | InChI=1S/C8H4ClF5N2O/c9-7(13)4(11)3(10)5(12)1-15-16-8(5,14)6(7)2-17-6/h1-2H2/t5-,6?,7-,8+/m0/s1 |
| InChIKey | MSGXVWCNUWNELP-SBEGJHHSSA-N |
| XLogP | 2.66 |
| TPSA | 37.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|