About 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane
2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane (PubChem CID 101064057) has the molecular formula C12H15BrO2S2
and a molecular weight of 335.29 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane |
| PubChem CID | 101064057 |
| Molecular Formula | C12H15BrO2S2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane |
| SMILES | COc1cc(Br)c(C2SCCCS2)cc1OC |
| InChI | InChI=1S/C12H15BrO2S2/c1-14-10-6-8(9(13)7-11(10)15-2)12-16-4-3-5-17-12/h6-7,12H,3-5H2,1-2H3 |
| InChIKey | GCYQTWMJEBAZPQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane?
The IUPAC name of 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane (CID 101064057) is 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane.
What is the SMILES notation for 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane?
The canonical SMILES for 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane is COc1cc(Br)c(C2SCCCS2)cc1OC.
What is the InChIKey of 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane?
The InChIKey is GCYQTWMJEBAZPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO2S2/c1-14-10-6-8(9(13)7-11(10)15-2)12-16-4-3-5-17-12/h6-7,12H,3-5H2,1-2H3.
What are the key properties of 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane?
2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane has a molecular weight of 335.29 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-4,5-dimethoxyphenyl)-1,3-dithiane is sourced from PubChem (CID 101064057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).