About [(E)-hex-3-en-3-yl] methyl carbonate
[(E)-hex-3-en-3-yl] methyl carbonate (PubChem CID 101064262) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is [(E)-hex-3-en-3-yl] methyl carbonate.
Molecular Properties
| Compound Name | [(E)-hex-3-en-3-yl] methyl carbonate |
| PubChem CID | 101064262 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(E)-hex-3-en-3-yl] methyl carbonate |
| SMILES | CC/C=C(\CC)OC(=O)OC |
| InChI | InChI=1S/C8H14O3/c1-4-6-7(5-2)11-8(9)10-3/h6H,4-5H2,1-3H3/b7-6+ |
| InChIKey | UMESOVVYGUDPGS-VOTSOKGWSA-N |
| XLogP | 2.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-3-en-3-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-3-en-3-yl] methyl carbonate?
The IUPAC name of [(E)-hex-3-en-3-yl] methyl carbonate (CID 101064262) is [(E)-hex-3-en-3-yl] methyl carbonate.
What is the SMILES notation for [(E)-hex-3-en-3-yl] methyl carbonate?
The canonical SMILES for [(E)-hex-3-en-3-yl] methyl carbonate is CC/C=C(\CC)OC(=O)OC.
What is the InChIKey of [(E)-hex-3-en-3-yl] methyl carbonate?
The InChIKey is UMESOVVYGUDPGS-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H14O3/c1-4-6-7(5-2)11-8(9)10-3/h6H,4-5H2,1-3H3/b7-6+.
What are the key properties of [(E)-hex-3-en-3-yl] methyl carbonate?
[(E)-hex-3-en-3-yl] methyl carbonate has a molecular weight of 158.20 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-3-en-3-yl] methyl carbonate is sourced from PubChem (CID 101064262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).