C8H13Br3 — CID 101064314
(1R,2S,4R)-1,2-dibromo-1-(bromomethyl)-4-methylcyclohexane (PubChem CID 101064314) has the molecular formula C8H13Br3 and a molecular weight of 348.90 g/mol. Its IUPAC name is (1R,2S,4R)-1,2-dibromo-1-(bromomethyl)-4-methylcyclohexane.
| Compound Name | (1R,2S,4R)-1,2-dibromo-1-(bromomethyl)-4-methylcyclohexane |
|---|---|
| PubChem CID | 101064314 |
| Molecular Formula | C8H13Br3 |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 345.86 |
| IUPAC Name | (1R,2S,4R)-1,2-dibromo-1-(bromomethyl)-4-methylcyclohexane |
| SMILES | C[C@@H]1CC[C@@](Br)(CBr)[C@@H](Br)C1 |
| InChI | InChI=1S/C8H13Br3/c1-6-2-3-8(11,5-9)7(10)4-6/h6-7H,2-5H2,1H3/t6-,7+,8-/m1/s1 |
| InChIKey | RVDNGXRLHBQOPN-GJMOJQLCSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|