C11H12O3 — CID 101064560
(1S,8R,9S,10S)-10-methoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-ol (PubChem CID 101064560) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (1S,8R,9S,10S)-10-methoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-ol.
| Compound Name | (1S,8R,9S,10S)-10-methoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-ol |
|---|---|
| PubChem CID | 101064560 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (1S,8R,9S,10S)-10-methoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-ol |
| SMILES | CO[C@H]1[C@@H](O)[C@@H]2O[C@H]1c1ccccc12 |
| InChI | InChI=1S/C11H12O3/c1-13-11-8(12)9-6-4-2-3-5-7(6)10(11)14-9/h2-5,8-12H,1H3/t8-,9+,10-,11-/m0/s1 |
| InChIKey | VQMNYHCKCYISKS-VLEAKVRGSA-N |
| XLogP | 1.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |