About (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine
(2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine (PubChem CID 101064795) has the molecular formula C20H27NO2
and a molecular weight of 313.44 g/mol. Its IUPAC name is (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine |
| PubChem CID | 101064795 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine |
| SMILES | COc1cc(CCCc2ccccc2)cc(OC)c1C[C@@H](C)N |
| InChI | InChI=1S/C20H27NO2/c1-15(21)12-18-19(22-2)13-17(14-20(18)23-3)11-7-10-16-8-5-4-6-9-16/h4-6,8-9,13-15H,7,10-12,21H2,1-3H3/t15-/m1/s1 |
| InChIKey | BLTUEXQAJVYGCR-OAHLLOKOSA-N |
| XLogP | 3.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine?
The IUPAC name of (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine (CID 101064795) is (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine.
What is the SMILES notation for (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine?
The canonical SMILES for (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine is COc1cc(CCCc2ccccc2)cc(OC)c1C[C@@H](C)N.
What is the InChIKey of (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine?
The InChIKey is BLTUEXQAJVYGCR-OAHLLOKOSA-N. The full InChI is InChI=1S/C20H27NO2/c1-15(21)12-18-19(22-2)13-17(14-20(18)23-3)11-7-10-16-8-5-4-6-9-16/h4-6,8-9,13-15H,7,10-12,21H2,1-3H3/t15-/m1/s1.
What are the key properties of (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine?
(2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine has a molecular weight of 313.44 g/mol, XLogP of 3.77, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[2,6-dimethoxy-4-(3-phenylpropyl)phenyl]propan-2-amine is sourced from PubChem (CID 101064795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).