C23H24N4O9 — CID 101065494
[(3R,4R,5R,6R)-4,5-diacetyloxy-6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)oxan-3-yl] acetate (PubChem CID 101065494) has the molecular formula C23H24N4O9 and a molecular weight of 500.46 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 101065494 |
| Molecular Formula | C23H24N4O9 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C23H24N4O9/c1-9-6-14-15(7-10(9)2)27(20-17(24-14)21(31)26-23(32)25-20)22-19(36-13(5)30)18(35-12(4)29)16(8-33-22)34-11(3)28/h6-7,16,18-19,22H,8H2,1-5H3,(H,26,31,32)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | VOTKWDKQQOUAQF-WGQQHEPDSA-N |
| XLogP | 0.53 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|