About (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene
(1Z,3E)-1-chloro-4-methoxyocta-1,3-diene (PubChem CID 101065509) has the molecular formula C9H15ClO
and a molecular weight of 174.67 g/mol. Its IUPAC name is (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene.
Molecular Properties
| Compound Name | (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene |
| PubChem CID | 101065509 |
| Molecular Formula | C9H15ClO |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene |
| SMILES | CCCC/C(=C\C=C/Cl)OC |
| InChI | InChI=1S/C9H15ClO/c1-3-4-6-9(11-2)7-5-8-10/h5,7-8H,3-4,6H2,1-2H3/b8-5-,9-7+ |
| InChIKey | BXERRFIFBDUCFF-ANVCMGODSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene?
The IUPAC name of (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene (CID 101065509) is (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene.
What is the SMILES notation for (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene?
The canonical SMILES for (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene is CCCC/C(=C\C=C/Cl)OC.
What is the InChIKey of (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene?
The InChIKey is BXERRFIFBDUCFF-ANVCMGODSA-N. The full InChI is InChI=1S/C9H15ClO/c1-3-4-6-9(11-2)7-5-8-10/h5,7-8H,3-4,6H2,1-2H3/b8-5-,9-7+.
What are the key properties of (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene?
(1Z,3E)-1-chloro-4-methoxyocta-1,3-diene has a molecular weight of 174.67 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-1-chloro-4-methoxyocta-1,3-diene is sourced from PubChem (CID 101065509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).