C42H50N7O7P — CID 101065540
N-[7-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]purin-2-yl]acetamide (PubChem CID 101065540) has the molecular formula C42H50N7O7P and a molecular weight of 795.88 g/mol. Its IUPAC name is N-[7-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]purin-2-yl]acetamide.
| Compound Name | N-[7-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]purin-2-yl]acetamide |
|---|---|
| PubChem CID | 101065540 |
| Molecular Formula | C42H50N7O7P |
| Molecular Weight | 795.88 g/mol |
| Exact Mass | 795.35 |
| IUPAC Name | N-[7-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]purin-2-yl]acetamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4nc(NC(C)=O)ncc43)C[C@@H]2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H50N7O7P/c1-28(2)49(29(3)4)57(54-23-11-22-43)56-37-24-39(48-27-45-40-36(48)25-44-41(47-40)46-30(5)50)55-38(37)26-53-42(31-12-9-8-10-13-31,32-14-18-34(51-6)19-15-32)33-16-20-35(52-7)21-17-33/h8-10,12-21,25,27-29,37-39H,11,23-24,26H2,1-7H3,(H,44,46,47,50)/t37-,38+,39+,57?/m0/s1 |
| InChIKey | GYOUCSDQVODSRT-FYJGSNHZSA-N |
| XLogP | 7.76 |
| TPSA | 155.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.88 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|