C11H13NO2S — CID 101065904
(3R,4S)-3-methoxy-1-prop-2-enyl-4-thiophen-3-ylazetidin-2-one (PubChem CID 101065904) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is (3R,4S)-3-methoxy-1-prop-2-enyl-4-thiophen-3-ylazetidin-2-one.
| Compound Name | (3R,4S)-3-methoxy-1-prop-2-enyl-4-thiophen-3-ylazetidin-2-one |
|---|---|
| PubChem CID | 101065904 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (3R,4S)-3-methoxy-1-prop-2-enyl-4-thiophen-3-ylazetidin-2-one |
| SMILES | C=CCN1C(=O)[C@H](OC)[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C11H13NO2S/c1-3-5-12-9(8-4-6-15-7-8)10(14-2)11(12)13/h3-4,6-7,9-10H,1,5H2,2H3/t9-,10+/m0/s1 |
| InChIKey | ZXGCNNKOYZFUJZ-VHSXEESVSA-N |
| XLogP | 1.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|