C12H19ClO2Si — CID 10106595
[(3aS,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-(chloromethyl)-dimethylsilane (PubChem CID 10106595) has the molecular formula C12H19ClO2Si and a molecular weight of 258.82 g/mol. Its IUPAC name is [(3aS,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-(chloromethyl)-dimethylsilane.
| Compound Name | [(3aS,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-(chloromethyl)-dimethylsilane |
|---|---|
| PubChem CID | 10106595 |
| Molecular Formula | C12H19ClO2Si |
| Molecular Weight | 258.82 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | [(3aS,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-(chloromethyl)-dimethylsilane |
| SMILES | CC1(C)O[C@H]2C=CC=C([Si](C)(C)CCl)[C@H]2O1 |
| InChI | InChI=1S/C12H19ClO2Si/c1-12(2)14-9-6-5-7-10(11(9)15-12)16(3,4)8-13/h5-7,9,11H,8H2,1-4H3/t9-,11-/m0/s1 |
| InChIKey | ICOIELIGAJCJCF-ONGXEEELSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|