C12H10N3O2S+ — CID 10106608
4-(2-methyl-1,3-thiazol-4-yl)-3-phenyl-2H-oxadiazol-3-ium-5-one (PubChem CID 10106608) has the molecular formula C12H10N3O2S+ and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-(2-methyl-1,3-thiazol-4-yl)-3-phenyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-(2-methyl-1,3-thiazol-4-yl)-3-phenyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 10106608 |
| Molecular Formula | C12H10N3O2S+ |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-(2-methyl-1,3-thiazol-4-yl)-3-phenyl-2H-oxadiazol-3-ium-5-one |
| SMILES | Cc1nc(-c2c(=O)o[nH][n+]2-c2ccccc2)cs1 |
| InChI | InChI=1S/C12H9N3O2S/c1-8-13-10(7-18-8)11-12(16)17-14-15(11)9-5-3-2-4-6-9/h2-7H,1H3/p+1 |
| InChIKey | STDDNGFJRAUYDY-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|